C17H18BrF5N2O — CID 155344203
(5R)-3-bromo-5-[1-[[4-(1,1,2,2,2-pentafluoroethyl)phenyl]methyl]piperidin-4-yl]-4,5-dihydro-1,2-oxazole (PubChem CID 155344203) has the molecular formula C17H18BrF5N2O and a molecular weight of 441.24 g/mol. Its IUPAC name is (5R)-3-bromo-5-[1-[[4-(1,1,2,2,2-pentafluoroethyl)phenyl]methyl]piperidin-4-yl]-4,5-dihydro-1,2-oxazole.
| Compound Name | (5R)-3-bromo-5-[1-[[4-(1,1,2,2,2-pentafluoroethyl)phenyl]methyl]piperidin-4-yl]-4,5-dihydro-1,2-oxazole |
|---|---|
| PubChem CID | 155344203 |
| Molecular Formula | C17H18BrF5N2O |
| Molecular Weight | 441.24 g/mol |
| Exact Mass | 440.05 |
| IUPAC Name | (5R)-3-bromo-5-[1-[[4-(1,1,2,2,2-pentafluoroethyl)phenyl]methyl]piperidin-4-yl]-4,5-dihydro-1,2-oxazole |
| SMILES | FC(F)(F)C(F)(F)c1ccc(CN2CCC([C@H]3CC(Br)=NO3)CC2)cc1 |
| InChI | InChI=1S/C17H18BrF5N2O/c18-15-9-14(26-24-15)12-5-7-25(8-6-12)10-11-1-3-13(4-2-11)16(19,20)17(21,22)23/h1-4,12,14H,5-10H2/t14-/m1/s1 |
| InChIKey | GXGNQNOBBGDUMO-CQSZACIVSA-N |
| XLogP | 5.05 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.24 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|