About 6-chloro-2H-indole;hydrochloride
6-chloro-2H-indole;hydrochloride (PubChem CID 155344529) has the molecular formula C8H7Cl2N
and a molecular weight of 188.06 g/mol. Its IUPAC name is 6-chloro-2H-indole;hydrochloride.
Molecular Properties
| Compound Name | 6-chloro-2H-indole;hydrochloride |
| PubChem CID | 155344529 |
| Molecular Formula | C8H7Cl2N |
| Molecular Weight | 188.06 g/mol |
| Exact Mass | 187.00 |
| IUPAC Name | 6-chloro-2H-indole;hydrochloride |
| SMILES | Cl.Clc1ccc2c(c1)=NCC=2 |
| InChI | InChI=1S/C8H6ClN.ClH/c9-7-2-1-6-3-4-10-8(6)5-7;/h1-3,5H,4H2;1H |
| InChIKey | FSBFRZMEKASBBY-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.06 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6-chloro-2H-indole;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-2H-indole;hydrochloride?
The IUPAC name of 6-chloro-2H-indole;hydrochloride (CID 155344529) is 6-chloro-2H-indole;hydrochloride.
What is the SMILES notation for 6-chloro-2H-indole;hydrochloride?
The canonical SMILES for 6-chloro-2H-indole;hydrochloride is Cl.Clc1ccc2c(c1)=NCC=2.
What is the InChIKey of 6-chloro-2H-indole;hydrochloride?
The InChIKey is FSBFRZMEKASBBY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6ClN.ClH/c9-7-2-1-6-3-4-10-8(6)5-7;/h1-3,5H,4H2;1H.
What are the key properties of 6-chloro-2H-indole;hydrochloride?
6-chloro-2H-indole;hydrochloride has a molecular weight of 188.06 g/mol, XLogP of 1.18, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-2H-indole;hydrochloride is sourced from PubChem (CID 155344529), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).