C30H23FN4O4 — CID 155344727
N-[4-fluoro-2-[(4R)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]-4-nitro-2-[(4R)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]aniline (PubChem CID 155344727) has the molecular formula C30H23FN4O4 and a molecular weight of 522.54 g/mol. Its IUPAC name is N-[4-fluoro-2-[(4R)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]-4-nitro-2-[(4R)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]aniline.
| Compound Name | N-[4-fluoro-2-[(4R)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]-4-nitro-2-[(4R)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]aniline |
|---|---|
| PubChem CID | 155344727 |
| Molecular Formula | C30H23FN4O4 |
| Molecular Weight | 522.54 g/mol |
| Exact Mass | 522.17 |
| IUPAC Name | N-[4-fluoro-2-[(4R)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]-4-nitro-2-[(4R)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]aniline |
| SMILES | O=[N+]([O-])c1ccc(Nc2ccc(F)cc2C2=N[C@H](c3ccccc3)CO2)c(C2=N[C@H](c3ccccc3)CO2)c1 |
| InChI | InChI=1S/C30H23FN4O4/c31-21-11-13-25(23(15-21)29-33-27(17-38-29)19-7-3-1-4-8-19)32-26-14-12-22(35(36)37)16-24(26)30-34-28(18-39-30)20-9-5-2-6-10-20/h1-16,27-28,32H,17-18H2/t27-,28-/m0/s1 |
| InChIKey | ADGGIKMAJLBUMM-NSOVKSMOSA-N |
| XLogP | 6.51 |
| TPSA | 98.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.54 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|