C28H33BrFN5O5 — CID 155344882
tert-butyl (3S)-4-[7-bromo-6-fluoro-1-(4-methyl-2-propan-2-yl-3-pyridinyl)-3-nitro-2-oxoquinolin-4-yl]-3-methylpiperazine-1-carboxylate (PubChem CID 155344882) has the molecular formula C28H33BrFN5O5 and a molecular weight of 618.50 g/mol. Its IUPAC name is tert-butyl (3S)-4-[7-bromo-6-fluoro-1-(4-methyl-2-propan-2-yl-3-pyridinyl)-3-nitro-2-oxoquinolin-4-yl]-3-methylpiperazine-1-carboxylate.
| Compound Name | tert-butyl (3S)-4-[7-bromo-6-fluoro-1-(4-methyl-2-propan-2-yl-3-pyridinyl)-3-nitro-2-oxoquinolin-4-yl]-3-methylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 155344882 |
| Molecular Formula | C28H33BrFN5O5 |
| Molecular Weight | 618.50 g/mol |
| Exact Mass | 617.16 |
| IUPAC Name | tert-butyl (3S)-4-[7-bromo-6-fluoro-1-(4-methyl-2-propan-2-yl-3-pyridinyl)-3-nitro-2-oxoquinolin-4-yl]-3-methylpiperazine-1-carboxylate |
| SMILES | Cc1ccnc(C(C)C)c1-n1c(=O)c([N+](=O)[O-])c(N2CCN(C(=O)OC(C)(C)C)C[C@@H]2C)c2cc(F)c(Br)cc21 |
| InChI | InChI=1S/C28H33BrFN5O5/c1-15(2)22-23(16(3)8-9-31-22)34-21-13-19(29)20(30)12-18(21)24(25(26(34)36)35(38)39)33-11-10-32(14-17(33)4)27(37)40-28(5,6)7/h8-9,12-13,15,17H,10-11,14H2,1-7H3/t17-/m0/s1 |
| InChIKey | ULOIDOJPJXLUNT-KRWDZBQOSA-N |
| XLogP | 6.07 |
| TPSA | 110.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.50 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|