C32H34F2N6O2 — CID 155344925
6-fluoro-7-(2-fluoro-6-hydroxyphenyl)-4-(6-methyl-7-methylidene-3,4,6,8,9,9a-hexahydro-1H-pyrido[1,2-a]pyrazin-2-yl)-1-(4-methyl-2-propan-2-yl-3-pyridinyl)pyrido[2,3-d]pyrimidin-2-one (PubChem CID 155344925) has the molecular formula C32H34F2N6O2 and a molecular weight of 572.66 g/mol. Its IUPAC name is 6-fluoro-7-(2-fluoro-6-hydroxyphenyl)-4-(6-methyl-7-methylidene-3,4,6,8,9,9a-hexahydro-1H-pyrido[1,2-a]pyrazin-2-yl)-1-(4-methyl-2-propan-2-yl-3-pyridinyl)pyrido[2,3-d]pyrimidin-2-one.
| Compound Name | 6-fluoro-7-(2-fluoro-6-hydroxyphenyl)-4-(6-methyl-7-methylidene-3,4,6,8,9,9a-hexahydro-1H-pyrido[1,2-a]pyrazin-2-yl)-1-(4-methyl-2-propan-2-yl-3-pyridinyl)pyrido[2,3-d]pyrimidin-2-one |
|---|---|
| PubChem CID | 155344925 |
| Molecular Formula | C32H34F2N6O2 |
| Molecular Weight | 572.66 g/mol |
| Exact Mass | 572.27 |
| IUPAC Name | 6-fluoro-7-(2-fluoro-6-hydroxyphenyl)-4-(6-methyl-7-methylidene-3,4,6,8,9,9a-hexahydro-1H-pyrido[1,2-a]pyrazin-2-yl)-1-(4-methyl-2-propan-2-yl-3-pyridinyl)pyrido[2,3-d]pyrimidin-2-one |
| SMILES | C=C1CCC2CN(c3nc(=O)n(-c4c(C)ccnc4C(C)C)c4nc(-c5c(O)cccc5F)c(F)cc34)CCN2C1C |
| InChI | InChI=1S/C32H34F2N6O2/c1-17(2)27-29(19(4)11-12-35-27)40-31-22(15-24(34)28(36-31)26-23(33)7-6-8-25(26)41)30(37-32(40)42)38-13-14-39-20(5)18(3)9-10-21(39)16-38/h6-8,11-12,15,17,20-21,41H,3,9-10,13-14,16H2,1-2,4-5H3 |
| InChIKey | OWYFUZTYPWSHMY-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 87.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.66 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|