C30H29Cl3FN7O2S — CID 155345163
7-(2-amino-3,5-dichloro-6-fluorophenyl)-6-chloro-4-(2-methyl-4-prop-2-enoylpiperazin-1-yl)-1-(4-methylsulfanyl-2-propan-2-yl-3-pyridinyl)pyrido[2,3-d]pyrimidin-2-one (PubChem CID 155345163) has the molecular formula C30H29Cl3FN7O2S and a molecular weight of 677.03 g/mol. Its IUPAC name is 7-(2-amino-3,5-dichloro-6-fluorophenyl)-6-chloro-4-(2-methyl-4-prop-2-enoylpiperazin-1-yl)-1-(4-methylsulfanyl-2-propan-2-yl-3-pyridinyl)pyrido[2,3-d]pyrimidin-2-one.
| Compound Name | 7-(2-amino-3,5-dichloro-6-fluorophenyl)-6-chloro-4-(2-methyl-4-prop-2-enoylpiperazin-1-yl)-1-(4-methylsulfanyl-2-propan-2-yl-3-pyridinyl)pyrido[2,3-d]pyrimidin-2-one |
|---|---|
| PubChem CID | 155345163 |
| Molecular Formula | C30H29Cl3FN7O2S |
| Molecular Weight | 677.03 g/mol |
| Exact Mass | 675.12 |
| IUPAC Name | 7-(2-amino-3,5-dichloro-6-fluorophenyl)-6-chloro-4-(2-methyl-4-prop-2-enoylpiperazin-1-yl)-1-(4-methylsulfanyl-2-propan-2-yl-3-pyridinyl)pyrido[2,3-d]pyrimidin-2-one |
| SMILES | C=CC(=O)N1CCN(c2nc(=O)n(-c3c(SC)ccnc3C(C)C)c3nc(-c4c(N)c(Cl)cc(Cl)c4F)c(Cl)cc23)C(C)C1 |
| InChI | InChI=1S/C30H29Cl3FN7O2S/c1-6-21(42)39-9-10-40(15(4)13-39)28-16-11-19(33)26(22-23(34)17(31)12-18(32)24(22)35)37-29(16)41(30(43)38-28)27-20(44-5)7-8-36-25(27)14(2)3/h6-8,11-12,14-15H,1,9-10,13,35H2,2-5H3 |
| InChIKey | JGSMUYMXOKKRRY-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 110.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.03 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|