C14H15FN2S — CID 155345548
5-(6-fluoro-1-benzothiophen-4-yl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole (PubChem CID 155345548) has the molecular formula C14H15FN2S and a molecular weight of 262.35 g/mol. Its IUPAC name is 5-(6-fluoro-1-benzothiophen-4-yl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole.
| Compound Name | 5-(6-fluoro-1-benzothiophen-4-yl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole |
|---|---|
| PubChem CID | 155345548 |
| Molecular Formula | C14H15FN2S |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.09 |
| IUPAC Name | 5-(6-fluoro-1-benzothiophen-4-yl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole |
| SMILES | Fc1cc(N2CC3CNCC3C2)c2ccsc2c1 |
| InChI | InChI=1S/C14H15FN2S/c15-11-3-13(12-1-2-18-14(12)4-11)17-7-9-5-16-6-10(9)8-17/h1-4,9-10,16H,5-8H2 |
| InChIKey | LUOCNDOETVJRAU-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |