C20H24N2O4S — CID 155345569
6-(1-benzothiophen-7-yl)-2,3,3a,4,5,7,8,8a-octahydro-1H-pyrrolo[3,4-d]azepine;(Z)-but-2-enedioic acid (PubChem CID 155345569) has the molecular formula C20H24N2O4S and a molecular weight of 388.49 g/mol. Its IUPAC name is 6-(1-benzothiophen-7-yl)-2,3,3a,4,5,7,8,8a-octahydro-1H-pyrrolo[3,4-d]azepine;(Z)-but-2-enedioic acid.
| Compound Name | 6-(1-benzothiophen-7-yl)-2,3,3a,4,5,7,8,8a-octahydro-1H-pyrrolo[3,4-d]azepine;(Z)-but-2-enedioic acid |
|---|---|
| PubChem CID | 155345569 |
| Molecular Formula | C20H24N2O4S |
| Molecular Weight | 388.49 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | 6-(1-benzothiophen-7-yl)-2,3,3a,4,5,7,8,8a-octahydro-1H-pyrrolo[3,4-d]azepine;(Z)-but-2-enedioic acid |
| SMILES | O=C(O)/C=C\C(=O)O.c1cc(N2CCC3CNCC3CC2)c2sccc2c1 |
| InChI | InChI=1S/C16H20N2S.C4H4O4/c1-2-12-6-9-19-16(12)15(3-1)18-7-4-13-10-17-11-14(13)5-8-18;5-3(6)1-2-4(7)8/h1-3,6,9,13-14,17H,4-5,7-8,10-11H2;1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | WILDSUJFUATARN-BTJKTKAUSA-N |
| XLogP | 3.05 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.49 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|