C19H22N2O4 — CID 155345654
2-methyl-5-naphthalen-1-yl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole;oxalic acid (PubChem CID 155345654) has the molecular formula C19H22N2O4 and a molecular weight of 342.39 g/mol. Its IUPAC name is 2-methyl-5-naphthalen-1-yl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole;oxalic acid.
| Compound Name | 2-methyl-5-naphthalen-1-yl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole;oxalic acid |
|---|---|
| PubChem CID | 155345654 |
| Molecular Formula | C19H22N2O4 |
| Molecular Weight | 342.39 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | 2-methyl-5-naphthalen-1-yl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole;oxalic acid |
| SMILES | CN1CC2CN(c3cccc4ccccc34)CC2C1.O=C(O)C(=O)O |
| InChI | InChI=1S/C17H20N2.C2H2O4/c1-18-9-14-11-19(12-15(14)10-18)17-8-4-6-13-5-2-3-7-16(13)17;3-1(4)2(5)6/h2-8,14-15H,9-12H2,1H3;(H,3,4)(H,5,6) |
| InChIKey | WKOTYKSUGDVNSQ-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.39 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|