C17H20ClN — CID 155345745
5-naphthalen-2-yl-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrole;hydrochloride (PubChem CID 155345745) has the molecular formula C17H20ClN and a molecular weight of 273.81 g/mol. Its IUPAC name is 5-naphthalen-2-yl-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrole;hydrochloride.
| Compound Name | 5-naphthalen-2-yl-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrole;hydrochloride |
|---|---|
| PubChem CID | 155345745 |
| Molecular Formula | C17H20ClN |
| Molecular Weight | 273.81 g/mol |
| Exact Mass | 273.13 |
| IUPAC Name | 5-naphthalen-2-yl-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrole;hydrochloride |
| SMILES | Cl.c1ccc2cc(C3CC4CNCC4C3)ccc2c1 |
| InChI | InChI=1S/C17H19N.ClH/c1-2-4-13-7-14(6-5-12(13)3-1)15-8-16-10-18-11-17(16)9-15;/h1-7,15-18H,8-11H2;1H |
| InChIKey | YFQIYBBKLQZJNW-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.81 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |