C15H17Cl2NO3 — CID 155346332
3-(1-aminobutan-2-yloxy)-8-chloronaphthalene-2-carboxylic acid;hydrochloride (PubChem CID 155346332) has the molecular formula C15H17Cl2NO3 and a molecular weight of 330.21 g/mol. Its IUPAC name is 3-(1-aminobutan-2-yloxy)-8-chloronaphthalene-2-carboxylic acid;hydrochloride.
| Compound Name | 3-(1-aminobutan-2-yloxy)-8-chloronaphthalene-2-carboxylic acid;hydrochloride |
|---|---|
| PubChem CID | 155346332 |
| Molecular Formula | C15H17Cl2NO3 |
| Molecular Weight | 330.21 g/mol |
| Exact Mass | 329.06 |
| IUPAC Name | 3-(1-aminobutan-2-yloxy)-8-chloronaphthalene-2-carboxylic acid;hydrochloride |
| SMILES | CCC(CN)Oc1cc2cccc(Cl)c2cc1C(=O)O.Cl |
| InChI | InChI=1S/C15H16ClNO3.ClH/c1-2-10(8-17)20-14-6-9-4-3-5-13(16)11(9)7-12(14)15(18)19;/h3-7,10H,2,8,17H2,1H3,(H,18,19);1H |
| InChIKey | JBIPAZOITRUHHM-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.21 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |