C28H30NO3PS2 — CID 155346737
[1-(3-diphenylphosphorylcarbonyl-2,4,6-trimethylanilino)-2-methyl-1-oxopropan-2-yl] ethanedithioate (PubChem CID 155346737) has the molecular formula C28H30NO3PS2 and a molecular weight of 523.66 g/mol. Its IUPAC name is [1-(3-diphenylphosphorylcarbonyl-2,4,6-trimethylanilino)-2-methyl-1-oxopropan-2-yl] ethanedithioate.
| Compound Name | [1-(3-diphenylphosphorylcarbonyl-2,4,6-trimethylanilino)-2-methyl-1-oxopropan-2-yl] ethanedithioate |
|---|---|
| PubChem CID | 155346737 |
| Molecular Formula | C28H30NO3PS2 |
| Molecular Weight | 523.66 g/mol |
| Exact Mass | 523.14 |
| IUPAC Name | [1-(3-diphenylphosphorylcarbonyl-2,4,6-trimethylanilino)-2-methyl-1-oxopropan-2-yl] ethanedithioate |
| SMILES | CC(=S)SC(C)(C)C(=O)Nc1c(C)cc(C)c(C(=O)P(=O)(c2ccccc2)c2ccccc2)c1C |
| InChI | InChI=1S/C28H30NO3PS2/c1-18-17-19(2)25(29-27(31)28(5,6)35-21(4)34)20(3)24(18)26(30)33(32,22-13-9-7-10-14-22)23-15-11-8-12-16-23/h7-17H,1-6H3,(H,29,31) |
| InChIKey | MEEWYVJNFXFLAP-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.66 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|