C28H40N2 — CID 155346817
(3Z,5Z)-N-[3-[(3Z,6Z,8Z)-2-cyclopentyl-3-methyldeca-1,3,6,8-tetraen-4-yl]iminobut-1-en-2-yl]-5-methylhepta-1,3,5-trien-2-amine (PubChem CID 155346817) has the molecular formula C28H40N2 and a molecular weight of 404.64 g/mol. Its IUPAC name is (3Z,5Z)-N-[3-[(3Z,6Z,8Z)-2-cyclopentyl-3-methyldeca-1,3,6,8-tetraen-4-yl]iminobut-1-en-2-yl]-5-methylhepta-1,3,5-trien-2-amine.
| Compound Name | (3Z,5Z)-N-[3-[(3Z,6Z,8Z)-2-cyclopentyl-3-methyldeca-1,3,6,8-tetraen-4-yl]iminobut-1-en-2-yl]-5-methylhepta-1,3,5-trien-2-amine |
|---|---|
| PubChem CID | 155346817 |
| Molecular Formula | C28H40N2 |
| Molecular Weight | 404.64 g/mol |
| Exact Mass | 404.32 |
| IUPAC Name | (3Z,5Z)-N-[3-[(3Z,6Z,8Z)-2-cyclopentyl-3-methyldeca-1,3,6,8-tetraen-4-yl]iminobut-1-en-2-yl]-5-methylhepta-1,3,5-trien-2-amine |
| SMILES | C=C(/C=C\C(C)=C/C)NC(=C)/C(C)=N/C(C/C=C\C=C/C)=C(/C)C(=C)C1CCCC1 |
| InChI | InChI=1S/C28H40N2/c1-9-11-12-13-18-28(24(6)23(5)27-16-14-15-17-27)30-26(8)25(7)29-22(4)20-19-21(3)10-2/h9-13,19-20,27,29H,4-5,7,14-18H2,1-3,6,8H3/b11-9-,13-12-,20-19-,21-10-,28-24-,30-26+ |
| InChIKey | UPTZAYYQSTZMAW-MTJAQNSUSA-N |
| XLogP | 8.13 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.64 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|