C21H31F3N2 — CID 155347183
7-(2-cyclohexylethyl)-2-(3,3,4-trifluorobutyl)-5,6,8,9-tetrahydropyrido[2,3-d]azepine (PubChem CID 155347183) has the molecular formula C21H31F3N2 and a molecular weight of 368.49 g/mol. Its IUPAC name is 7-(2-cyclohexylethyl)-2-(3,3,4-trifluorobutyl)-5,6,8,9-tetrahydropyrido[2,3-d]azepine.
| Compound Name | 7-(2-cyclohexylethyl)-2-(3,3,4-trifluorobutyl)-5,6,8,9-tetrahydropyrido[2,3-d]azepine |
|---|---|
| PubChem CID | 155347183 |
| Molecular Formula | C21H31F3N2 |
| Molecular Weight | 368.49 g/mol |
| Exact Mass | 368.24 |
| IUPAC Name | 7-(2-cyclohexylethyl)-2-(3,3,4-trifluorobutyl)-5,6,8,9-tetrahydropyrido[2,3-d]azepine |
| SMILES | FCC(F)(F)CCc1ccc2c(n1)CCN(CCC1CCCCC1)CC2 |
| InChI | InChI=1S/C21H31F3N2/c22-16-21(23,24)12-8-19-7-6-18-10-14-26(15-11-20(18)25-19)13-9-17-4-2-1-3-5-17/h6-7,17H,1-5,8-16H2 |
| InChIKey | QIFFLJMHWZIAPF-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.49 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |