C27H33F3N6O2 — CID 155347272
2-methyl-N-[4-[2-[2-(2,2,2-trifluoroethoxy)-5,6,8,9-tetrahydropyrido[2,3-d]azepin-7-yl]ethyl]piperidin-1-yl]indazole-4-carboxamide (PubChem CID 155347272) has the molecular formula C27H33F3N6O2 and a molecular weight of 530.60 g/mol. Its IUPAC name is 2-methyl-N-[4-[2-[2-(2,2,2-trifluoroethoxy)-5,6,8,9-tetrahydropyrido[2,3-d]azepin-7-yl]ethyl]piperidin-1-yl]indazole-4-carboxamide.
| Compound Name | 2-methyl-N-[4-[2-[2-(2,2,2-trifluoroethoxy)-5,6,8,9-tetrahydropyrido[2,3-d]azepin-7-yl]ethyl]piperidin-1-yl]indazole-4-carboxamide |
|---|---|
| PubChem CID | 155347272 |
| Molecular Formula | C27H33F3N6O2 |
| Molecular Weight | 530.60 g/mol |
| Exact Mass | 530.26 |
| IUPAC Name | 2-methyl-N-[4-[2-[2-(2,2,2-trifluoroethoxy)-5,6,8,9-tetrahydropyrido[2,3-d]azepin-7-yl]ethyl]piperidin-1-yl]indazole-4-carboxamide |
| SMILES | Cn1cc2c(C(=O)NN3CCC(CCN4CCc5ccc(OCC(F)(F)F)nc5CC4)CC3)cccc2n1 |
| InChI | InChI=1S/C27H33F3N6O2/c1-34-17-22-21(3-2-4-24(22)32-34)26(37)33-36-15-8-19(9-16-36)7-12-35-13-10-20-5-6-25(31-23(20)11-14-35)38-18-27(28,29)30/h2-6,17,19H,7-16,18H2,1H3,(H,33,37) |
| InChIKey | ZRSYGNXIJUXTIX-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 75.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.60 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |