C17H27F3N2OS — CID 155347357
2-cyclohexyl-N-[2-[5-ethyl-2-(2,2,2-trifluoroethoxy)-1,3-thiazol-4-yl]ethyl]ethanamine (PubChem CID 155347357) has the molecular formula C17H27F3N2OS and a molecular weight of 364.48 g/mol. Its IUPAC name is 2-cyclohexyl-N-[2-[5-ethyl-2-(2,2,2-trifluoroethoxy)-1,3-thiazol-4-yl]ethyl]ethanamine.
| Compound Name | 2-cyclohexyl-N-[2-[5-ethyl-2-(2,2,2-trifluoroethoxy)-1,3-thiazol-4-yl]ethyl]ethanamine |
|---|---|
| PubChem CID | 155347357 |
| Molecular Formula | C17H27F3N2OS |
| Molecular Weight | 364.48 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | 2-cyclohexyl-N-[2-[5-ethyl-2-(2,2,2-trifluoroethoxy)-1,3-thiazol-4-yl]ethyl]ethanamine |
| SMILES | CCc1sc(OCC(F)(F)F)nc1CCNCCC1CCCCC1 |
| InChI | InChI=1S/C17H27F3N2OS/c1-2-15-14(22-16(24-15)23-12-17(18,19)20)9-11-21-10-8-13-6-4-3-5-7-13/h13,21H,2-12H2,1H3 |
| InChIKey | WZUSQYCORKTJJT-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.48 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|