C31H39F2N5O2 — CID 155347405
N-[4-[2-[2-(3,3-difluorocyclopentyl)oxy-5,6,8,9-tetrahydropyrido[2,3-d]azepin-7-yl]ethyl]cyclohexyl]-2-methylindazole-4-carboxamide (PubChem CID 155347405) has the molecular formula C31H39F2N5O2 and a molecular weight of 551.68 g/mol. Its IUPAC name is N-[4-[2-[2-(3,3-difluorocyclopentyl)oxy-5,6,8,9-tetrahydropyrido[2,3-d]azepin-7-yl]ethyl]cyclohexyl]-2-methylindazole-4-carboxamide.
| Compound Name | N-[4-[2-[2-(3,3-difluorocyclopentyl)oxy-5,6,8,9-tetrahydropyrido[2,3-d]azepin-7-yl]ethyl]cyclohexyl]-2-methylindazole-4-carboxamide |
|---|---|
| PubChem CID | 155347405 |
| Molecular Formula | C31H39F2N5O2 |
| Molecular Weight | 551.68 g/mol |
| Exact Mass | 551.31 |
| IUPAC Name | N-[4-[2-[2-(3,3-difluorocyclopentyl)oxy-5,6,8,9-tetrahydropyrido[2,3-d]azepin-7-yl]ethyl]cyclohexyl]-2-methylindazole-4-carboxamide |
| SMILES | Cn1cc2c(C(=O)NC3CCC(CCN4CCc5ccc(OC6CCC(F)(F)C6)nc5CC4)CC3)cccc2n1 |
| InChI | InChI=1S/C31H39F2N5O2/c1-37-20-26-25(3-2-4-28(26)36-37)30(39)34-23-8-5-21(6-9-23)12-16-38-17-13-22-7-10-29(35-27(22)14-18-38)40-24-11-15-31(32,33)19-24/h2-4,7,10,20-21,23-24H,5-6,8-9,11-19H2,1H3,(H,34,39) |
| InChIKey | QJERAWQQAOXOKR-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.68 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |