C25H34F3N5O2 — CID 155347435
2-(5-methyl-1,2,4-oxadiazol-3-yl)-N-[4-[2-[2-(3,3,3-trifluoropropyl)-5,6,8,9-tetrahydropyrido[2,3-d]azepin-7-yl]ethyl]cyclohexyl]acetamide (PubChem CID 155347435) has the molecular formula C25H34F3N5O2 and a molecular weight of 493.57 g/mol. Its IUPAC name is 2-(5-methyl-1,2,4-oxadiazol-3-yl)-N-[4-[2-[2-(3,3,3-trifluoropropyl)-5,6,8,9-tetrahydropyrido[2,3-d]azepin-7-yl]ethyl]cyclohexyl]acetamide.
| Compound Name | 2-(5-methyl-1,2,4-oxadiazol-3-yl)-N-[4-[2-[2-(3,3,3-trifluoropropyl)-5,6,8,9-tetrahydropyrido[2,3-d]azepin-7-yl]ethyl]cyclohexyl]acetamide |
|---|---|
| PubChem CID | 155347435 |
| Molecular Formula | C25H34F3N5O2 |
| Molecular Weight | 493.57 g/mol |
| Exact Mass | 493.27 |
| IUPAC Name | 2-(5-methyl-1,2,4-oxadiazol-3-yl)-N-[4-[2-[2-(3,3,3-trifluoropropyl)-5,6,8,9-tetrahydropyrido[2,3-d]azepin-7-yl]ethyl]cyclohexyl]acetamide |
| SMILES | Cc1nc(CC(=O)NC2CCC(CCN3CCc4ccc(CCC(F)(F)F)nc4CC3)CC2)no1 |
| InChI | InChI=1S/C25H34F3N5O2/c1-17-29-23(32-35-17)16-24(34)31-20-5-2-18(3-6-20)9-13-33-14-10-19-4-7-21(8-12-25(26,27)28)30-22(19)11-15-33/h4,7,18,20H,2-3,5-6,8-16H2,1H3,(H,31,34) |
| InChIKey | CJSWEVQUNWOTCF-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 84.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.57 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |