C28H36F2N4O2 — CID 155347453
N-[4-[2-[2-(2,2-difluoroethoxy)-5,6,8,9-tetrahydropyrido[2,3-d]azepin-7-yl]ethyl]-1-bicyclo[2.2.2]octanyl]-2-methylpyridine-3-carboxamide (PubChem CID 155347453) has the molecular formula C28H36F2N4O2 and a molecular weight of 498.62 g/mol. Its IUPAC name is N-[4-[2-[2-(2,2-difluoroethoxy)-5,6,8,9-tetrahydropyrido[2,3-d]azepin-7-yl]ethyl]-1-bicyclo[2.2.2]octanyl]-2-methylpyridine-3-carboxamide.
| Compound Name | N-[4-[2-[2-(2,2-difluoroethoxy)-5,6,8,9-tetrahydropyrido[2,3-d]azepin-7-yl]ethyl]-1-bicyclo[2.2.2]octanyl]-2-methylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 155347453 |
| Molecular Formula | C28H36F2N4O2 |
| Molecular Weight | 498.62 g/mol |
| Exact Mass | 498.28 |
| IUPAC Name | N-[4-[2-[2-(2,2-difluoroethoxy)-5,6,8,9-tetrahydropyrido[2,3-d]azepin-7-yl]ethyl]-1-bicyclo[2.2.2]octanyl]-2-methylpyridine-3-carboxamide |
| SMILES | Cc1ncccc1C(=O)NC12CCC(CCN3CCc4ccc(OCC(F)F)nc4CC3)(CC1)CC2 |
| InChI | InChI=1S/C28H36F2N4O2/c1-20-22(3-2-15-31-20)26(35)33-28-11-8-27(9-12-28,10-13-28)14-18-34-16-6-21-4-5-25(36-19-24(29)30)32-23(21)7-17-34/h2-5,15,24H,6-14,16-19H2,1H3,(H,33,35) |
| InChIKey | UUBHNHBPLALWJT-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.62 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |