C27H35F2N5O2 — CID 155347461
(E)-N-[4-[2-[2-(2,2-difluoroethoxy)-5,6,8,9-tetrahydropyrido[2,3-d]azepin-7-yl]ethyl]cyclohexyl]-3-(2-methylpyrimidin-5-yl)prop-2-enamide (PubChem CID 155347461) has the molecular formula C27H35F2N5O2 and a molecular weight of 499.61 g/mol. Its IUPAC name is (E)-N-[4-[2-[2-(2,2-difluoroethoxy)-5,6,8,9-tetrahydropyrido[2,3-d]azepin-7-yl]ethyl]cyclohexyl]-3-(2-methylpyrimidin-5-yl)prop-2-enamide.
| Compound Name | (E)-N-[4-[2-[2-(2,2-difluoroethoxy)-5,6,8,9-tetrahydropyrido[2,3-d]azepin-7-yl]ethyl]cyclohexyl]-3-(2-methylpyrimidin-5-yl)prop-2-enamide |
|---|---|
| PubChem CID | 155347461 |
| Molecular Formula | C27H35F2N5O2 |
| Molecular Weight | 499.61 g/mol |
| Exact Mass | 499.28 |
| IUPAC Name | (E)-N-[4-[2-[2-(2,2-difluoroethoxy)-5,6,8,9-tetrahydropyrido[2,3-d]azepin-7-yl]ethyl]cyclohexyl]-3-(2-methylpyrimidin-5-yl)prop-2-enamide |
| SMILES | Cc1ncc(/C=C/C(=O)NC2CCC(CCN3CCc4ccc(OCC(F)F)nc4CC3)CC2)cn1 |
| InChI | InChI=1S/C27H35F2N5O2/c1-19-30-16-21(17-31-19)4-8-26(35)32-23-6-2-20(3-7-23)10-13-34-14-11-22-5-9-27(36-18-25(28)29)33-24(22)12-15-34/h4-5,8-9,16-17,20,23,25H,2-3,6-7,10-15,18H2,1H3,(H,32,35)/b8-4+ |
| InChIKey | XJSNUYSRIVRHKR-XBXARRHUSA-N |
| XLogP | 4.00 |
| TPSA | 80.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.61 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|