C28H36F3N5O — CID 155347516
(E)-3-(2-methylpyrimidin-5-yl)-N-[4-[2-[2-(3,3,3-trifluoropropyl)-5,6,8,9-tetrahydropyrido[2,3-d]azepin-7-yl]ethyl]cyclohexyl]prop-2-enamide (PubChem CID 155347516) has the molecular formula C28H36F3N5O and a molecular weight of 515.62 g/mol. Its IUPAC name is (E)-3-(2-methylpyrimidin-5-yl)-N-[4-[2-[2-(3,3,3-trifluoropropyl)-5,6,8,9-tetrahydropyrido[2,3-d]azepin-7-yl]ethyl]cyclohexyl]prop-2-enamide.
| Compound Name | (E)-3-(2-methylpyrimidin-5-yl)-N-[4-[2-[2-(3,3,3-trifluoropropyl)-5,6,8,9-tetrahydropyrido[2,3-d]azepin-7-yl]ethyl]cyclohexyl]prop-2-enamide |
|---|---|
| PubChem CID | 155347516 |
| Molecular Formula | C28H36F3N5O |
| Molecular Weight | 515.62 g/mol |
| Exact Mass | 515.29 |
| IUPAC Name | (E)-3-(2-methylpyrimidin-5-yl)-N-[4-[2-[2-(3,3,3-trifluoropropyl)-5,6,8,9-tetrahydropyrido[2,3-d]azepin-7-yl]ethyl]cyclohexyl]prop-2-enamide |
| SMILES | Cc1ncc(/C=C/C(=O)NC2CCC(CCN3CCc4ccc(CCC(F)(F)F)nc4CC3)CC2)cn1 |
| InChI | InChI=1S/C28H36F3N5O/c1-20-32-18-22(19-33-20)4-9-27(37)35-24-6-2-21(3-7-24)11-15-36-16-12-23-5-8-25(10-14-28(29,30)31)34-26(23)13-17-36/h4-5,8-9,18-19,21,24H,2-3,6-7,10-17H2,1H3,(H,35,37)/b9-4+ |
| InChIKey | NWTLRPXTJVTFDS-RUDMXATFSA-N |
| XLogP | 4.85 |
| TPSA | 71.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.62 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|