C27H53NO — CID 155347541
2-[(7-but-1-en-2-yl-3-tert-butyl-5,5,6,6,7,9,9-heptamethyldec-1-en-2-yl)amino]ethanol (PubChem CID 155347541) has the molecular formula C27H53NO and a molecular weight of 407.73 g/mol. Its IUPAC name is 2-[(7-but-1-en-2-yl-3-tert-butyl-5,5,6,6,7,9,9-heptamethyldec-1-en-2-yl)amino]ethanol.
| Compound Name | 2-[(7-but-1-en-2-yl-3-tert-butyl-5,5,6,6,7,9,9-heptamethyldec-1-en-2-yl)amino]ethanol |
|---|---|
| PubChem CID | 155347541 |
| Molecular Formula | C27H53NO |
| Molecular Weight | 407.73 g/mol |
| Exact Mass | 407.41 |
| IUPAC Name | 2-[(7-but-1-en-2-yl-3-tert-butyl-5,5,6,6,7,9,9-heptamethyldec-1-en-2-yl)amino]ethanol |
| SMILES | C=C(NCCO)C(CC(C)(C)C(C)(C)C(C)(CC(C)(C)C)C(=C)CC)C(C)(C)C |
| InChI | InChI=1S/C27H53NO/c1-15-20(2)27(14,19-23(4,5)6)26(12,13)25(10,11)18-22(24(7,8)9)21(3)28-16-17-29/h22,28-29H,2-3,15-19H2,1,4-14H3 |
| InChIKey | CAAGQYKBNFMRQP-UHFFFAOYSA-N |
| XLogP | 7.60 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.73 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|