C24H21BrF2N4O2 — CID 155347849
3-[4-amino-3-(methyliminomethyl)phenyl]-1-(4-bromophenyl)-7-(2,2-difluoroethoxy)-7,8-dihydro-1,8-naphthyridin-2-one (PubChem CID 155347849) has the molecular formula C24H21BrF2N4O2 and a molecular weight of 515.36 g/mol. Its IUPAC name is 3-[4-amino-3-(methyliminomethyl)phenyl]-1-(4-bromophenyl)-7-(2,2-difluoroethoxy)-7,8-dihydro-1,8-naphthyridin-2-one.
| Compound Name | 3-[4-amino-3-(methyliminomethyl)phenyl]-1-(4-bromophenyl)-7-(2,2-difluoroethoxy)-7,8-dihydro-1,8-naphthyridin-2-one |
|---|---|
| PubChem CID | 155347849 |
| Molecular Formula | C24H21BrF2N4O2 |
| Molecular Weight | 515.36 g/mol |
| Exact Mass | 514.08 |
| IUPAC Name | 3-[4-amino-3-(methyliminomethyl)phenyl]-1-(4-bromophenyl)-7-(2,2-difluoroethoxy)-7,8-dihydro-1,8-naphthyridin-2-one |
| SMILES | C/N=C/c1cc(-c2cc3c(n(-c4ccc(Br)cc4)c2=O)NC(OCC(F)F)C=C3)ccc1N |
| InChI | InChI=1S/C24H21BrF2N4O2/c1-29-12-16-10-14(2-8-20(16)28)19-11-15-3-9-22(33-13-21(26)27)30-23(15)31(24(19)32)18-6-4-17(25)5-7-18/h2-12,21-22,30H,13,28H2,1H3/b29-12+ |
| InChIKey | VWMXDBUZUDSICB-XKJRVUDJSA-N |
| XLogP | 4.94 |
| TPSA | 81.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.36 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|