C14H23FN2O — CID 155348345
N-butan-2-yl-N-[(1E,3E)-1-fluoro-5-(methylamino)octa-1,3,6-trien-4-yl]formamide (PubChem CID 155348345) has the molecular formula C14H23FN2O and a molecular weight of 254.35 g/mol. Its IUPAC name is N-butan-2-yl-N-[(1E,3E)-1-fluoro-5-(methylamino)octa-1,3,6-trien-4-yl]formamide.
| Compound Name | N-butan-2-yl-N-[(1E,3E)-1-fluoro-5-(methylamino)octa-1,3,6-trien-4-yl]formamide |
|---|---|
| PubChem CID | 155348345 |
| Molecular Formula | C14H23FN2O |
| Molecular Weight | 254.35 g/mol |
| Exact Mass | 254.18 |
| IUPAC Name | N-butan-2-yl-N-[(1E,3E)-1-fluoro-5-(methylamino)octa-1,3,6-trien-4-yl]formamide |
| SMILES | CC=CC(NC)/C(=C\C=C\F)N(C=O)C(C)CC |
| InChI | InChI=1S/C14H23FN2O/c1-5-8-13(16-4)14(9-7-10-15)17(11-18)12(3)6-2/h5,7-13,16H,6H2,1-4H3/b8-5?,10-7+,14-9+ |
| InChIKey | AIGKQIQDFQWKAP-UOGAJBPLSA-N |
| XLogP | 2.77 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.35 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|