About CID 155348940
CID 155348940 (PubChem CID 155348940) has the molecular formula C17H25N5O3
and a molecular weight of 347.42 g/mol.
Molecular Properties
| Compound Name | CID 155348940 |
| PubChem CID | 155348940 |
| Molecular Formula | C17H25N5O3 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.20 |
| IUPAC Name | — |
| SMILES | C1C2CC3CC1CC(C2)C31OOC2(CCC(Nc3nn[nH]n3)CC2)O1 |
| InChI | InChI=1S/C17H25N5O3/c1-3-16(4-2-14(1)18-15-19-21-22-20-15)23-17(25-24-16)12-6-10-5-11(8-12)9-13(17)7-10/h10-14H,1-9H2,(H2,18,19,20,21,22) |
| InChIKey | DLHCOEMSRRHZLI-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 94.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze CID 155348940 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 155348940?
The IUPAC name of CID 155348940 (CID 155348940) is not available.
What is the SMILES notation for CID 155348940?
The canonical SMILES for CID 155348940 is C1C2CC3CC1CC(C2)C31OOC2(CCC(Nc3nn[nH]n3)CC2)O1.
What is the InChIKey of CID 155348940?
The InChIKey is DLHCOEMSRRHZLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H25N5O3/c1-3-16(4-2-14(1)18-15-19-21-22-20-15)23-17(25-24-16)12-6-10-5-11(8-12)9-13(17)7-10/h10-14H,1-9H2,(H2,18,19,20,21,22).
What are the key properties of CID 155348940?
CID 155348940 has a molecular weight of 347.42 g/mol, XLogP of 2.38, 2 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for CID 155348940 is sourced from PubChem (CID 155348940), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).