About N-[(4,6-dimethoxypyrimidin-2-yl)carbamothioyl]pyridine-3-carboxamide
N-[(4,6-dimethoxypyrimidin-2-yl)carbamothioyl]pyridine-3-carboxamide (PubChem CID 15534902) has the molecular formula C13H13N5O3S
and a molecular weight of 319.35 g/mol. Its IUPAC name is N-[(4,6-dimethoxypyrimidin-2-yl)carbamothioyl]pyridine-3-carboxamide.
Molecular Properties
| Compound Name | N-[(4,6-dimethoxypyrimidin-2-yl)carbamothioyl]pyridine-3-carboxamide |
| PubChem CID | 15534902 |
| Molecular Formula | C13H13N5O3S |
| Molecular Weight | 319.35 g/mol |
| Exact Mass | 319.07 |
| IUPAC Name | N-[(4,6-dimethoxypyrimidin-2-yl)carbamothioyl]pyridine-3-carboxamide |
| SMILES | COc1cc(OC)nc(NC(=S)NC(=O)c2cccnc2)n1 |
| InChI | InChI=1S/C13H13N5O3S/c1-20-9-6-10(21-2)16-12(15-9)18-13(22)17-11(19)8-4-3-5-14-7-8/h3-7H,1-2H3,(H2,15,16,17,18,19,22) |
| InChIKey | UBOLPDKRUDBMNR-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 98.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.35 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze N-[(4,6-dimethoxypyrimidin-2-yl)carbamothioyl]pyridine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(4,6-dimethoxypyrimidin-2-yl)carbamothioyl]pyridine-3-carboxamide?
The IUPAC name of N-[(4,6-dimethoxypyrimidin-2-yl)carbamothioyl]pyridine-3-carboxamide (CID 15534902) is N-[(4,6-dimethoxypyrimidin-2-yl)carbamothioyl]pyridine-3-carboxamide.
What is the SMILES notation for N-[(4,6-dimethoxypyrimidin-2-yl)carbamothioyl]pyridine-3-carboxamide?
The canonical SMILES for N-[(4,6-dimethoxypyrimidin-2-yl)carbamothioyl]pyridine-3-carboxamide is COc1cc(OC)nc(NC(=S)NC(=O)c2cccnc2)n1.
What is the InChIKey of N-[(4,6-dimethoxypyrimidin-2-yl)carbamothioyl]pyridine-3-carboxamide?
The InChIKey is UBOLPDKRUDBMNR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13N5O3S/c1-20-9-6-10(21-2)16-12(15-9)18-13(22)17-11(19)8-4-3-5-14-7-8/h3-7H,1-2H3,(H2,15,16,17,18,19,22).
What are the key properties of N-[(4,6-dimethoxypyrimidin-2-yl)carbamothioyl]pyridine-3-carboxamide?
N-[(4,6-dimethoxypyrimidin-2-yl)carbamothioyl]pyridine-3-carboxamide has a molecular weight of 319.35 g/mol, XLogP of 1.02, 4 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(4,6-dimethoxypyrimidin-2-yl)carbamothioyl]pyridine-3-carboxamide is sourced from PubChem (CID 15534902), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).