C14H25FS — CID 155349060
ditert-butyl-fluoro-[(1E,3Z)-hexa-1,3,5-trienyl]-λ4-sulfane (PubChem CID 155349060) has the molecular formula C14H25FS and a molecular weight of 244.42 g/mol. Its IUPAC name is ditert-butyl-fluoro-[(1E,3Z)-hexa-1,3,5-trienyl]-λ4-sulfane.
| Compound Name | ditert-butyl-fluoro-[(1E,3Z)-hexa-1,3,5-trienyl]-λ4-sulfane |
|---|---|
| PubChem CID | 155349060 |
| Molecular Formula | C14H25FS |
| Molecular Weight | 244.42 g/mol |
| Exact Mass | 244.17 |
| IUPAC Name | ditert-butyl-fluoro-[(1E,3Z)-hexa-1,3,5-trienyl]-λ4-sulfane |
| SMILES | C=C/C=C\C=C\S(F)(C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C14H25FS/c1-8-9-10-11-12-16(15,13(2,3)4)14(5,6)7/h8-12H,1H2,2-7H3/b10-9-,12-11+ |
| InChIKey | ORYDUGREUYNBBX-XAZJVICWSA-N |
| XLogP | 5.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.42 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|