C23H21ClN4O2S — CID 155349249
3-[(7-chloroisoquinolin-1-yl)amino]-N-[[4-(methylamino)phenyl]methyl]benzenesulfonamide (PubChem CID 155349249) has the molecular formula C23H21ClN4O2S and a molecular weight of 452.97 g/mol. Its IUPAC name is 3-[(7-chloroisoquinolin-1-yl)amino]-N-[[4-(methylamino)phenyl]methyl]benzenesulfonamide.
| Compound Name | 3-[(7-chloroisoquinolin-1-yl)amino]-N-[[4-(methylamino)phenyl]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 155349249 |
| Molecular Formula | C23H21ClN4O2S |
| Molecular Weight | 452.97 g/mol |
| Exact Mass | 452.11 |
| IUPAC Name | 3-[(7-chloroisoquinolin-1-yl)amino]-N-[[4-(methylamino)phenyl]methyl]benzenesulfonamide |
| SMILES | CNc1ccc(CNS(=O)(=O)c2cccc(Nc3nccc4ccc(Cl)cc34)c2)cc1 |
| InChI | InChI=1S/C23H21ClN4O2S/c1-25-19-9-5-16(6-10-19)15-27-31(29,30)21-4-2-3-20(14-21)28-23-22-13-18(24)8-7-17(22)11-12-26-23/h2-14,25,27H,15H2,1H3,(H,26,28) |
| InChIKey | XCGUFFBJRSWQQD-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 83.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.97 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |