C13H16F3N — CID 155349381
3-[(1E,7Z)-cyclonona-1,4,7-trien-1-yl]-1,1,1-trifluoro-N-methylpropan-2-imine (PubChem CID 155349381) has the molecular formula C13H16F3N and a molecular weight of 243.27 g/mol. Its IUPAC name is 3-[(1E,7Z)-cyclonona-1,4,7-trien-1-yl]-1,1,1-trifluoro-N-methylpropan-2-imine.
| Compound Name | 3-[(1E,7Z)-cyclonona-1,4,7-trien-1-yl]-1,1,1-trifluoro-N-methylpropan-2-imine |
|---|---|
| PubChem CID | 155349381 |
| Molecular Formula | C13H16F3N |
| Molecular Weight | 243.27 g/mol |
| Exact Mass | 243.12 |
| IUPAC Name | 3-[(1E,7Z)-cyclonona-1,4,7-trien-1-yl]-1,1,1-trifluoro-N-methylpropan-2-imine |
| SMILES | C/N=C(/C/C1=C/CC=CC/C=C\C1)C(F)(F)F |
| InChI | InChI=1S/C13H16F3N/c1-17-12(13(14,15)16)10-11-8-6-4-2-3-5-7-9-11/h2,4-5,7-8H,3,6,9-10H2,1H3/b4-2?,7-5-,11-8+,17-12- |
| InChIKey | XSFYXYNMHLOMFL-BBHCEUEZSA-N |
| XLogP | 4.23 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.27 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|