C13H19FN2 — CID 155349838
(2Z,4E)-3-cyclobutyl-4-fluoro-N'-[(Z)-prop-1-enyl]hexa-2,4-dienimidamide (PubChem CID 155349838) has the molecular formula C13H19FN2 and a molecular weight of 222.31 g/mol. Its IUPAC name is (2Z,4E)-3-cyclobutyl-4-fluoro-N'-[(Z)-prop-1-enyl]hexa-2,4-dienimidamide.
| Compound Name | (2Z,4E)-3-cyclobutyl-4-fluoro-N'-[(Z)-prop-1-enyl]hexa-2,4-dienimidamide |
|---|---|
| PubChem CID | 155349838 |
| Molecular Formula | C13H19FN2 |
| Molecular Weight | 222.31 g/mol |
| Exact Mass | 222.15 |
| IUPAC Name | (2Z,4E)-3-cyclobutyl-4-fluoro-N'-[(Z)-prop-1-enyl]hexa-2,4-dienimidamide |
| SMILES | C/C=C\N=C(N)\C=C(C(/F)=C\C)\C1CCC1 |
| InChI | InChI=1S/C13H19FN2/c1-3-8-16-13(15)9-11(12(14)4-2)10-6-5-7-10/h3-4,8-10H,5-7H2,1-2H3,(H2,15,16)/b8-3-,11-9-,12-4+ |
| InChIKey | LFIJZRZJKPBCTQ-XIILXQSWSA-N |
| XLogP | 3.48 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.31 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|