C17H13F3N4O2S — CID 155349961
6-methyl-3-(1,3-thiazol-5-yl)-N-(3,4,5-trifluorophenyl)-6,7-dihydro-4H-[1,2]oxazolo[4,3-c]pyridine-5-carboxamide (PubChem CID 155349961) has the molecular formula C17H13F3N4O2S and a molecular weight of 394.38 g/mol. Its IUPAC name is 6-methyl-3-(1,3-thiazol-5-yl)-N-(3,4,5-trifluorophenyl)-6,7-dihydro-4H-[1,2]oxazolo[4,3-c]pyridine-5-carboxamide.
| Compound Name | 6-methyl-3-(1,3-thiazol-5-yl)-N-(3,4,5-trifluorophenyl)-6,7-dihydro-4H-[1,2]oxazolo[4,3-c]pyridine-5-carboxamide |
|---|---|
| PubChem CID | 155349961 |
| Molecular Formula | C17H13F3N4O2S |
| Molecular Weight | 394.38 g/mol |
| Exact Mass | 394.07 |
| IUPAC Name | 6-methyl-3-(1,3-thiazol-5-yl)-N-(3,4,5-trifluorophenyl)-6,7-dihydro-4H-[1,2]oxazolo[4,3-c]pyridine-5-carboxamide |
| SMILES | CC1Cc2noc(-c3cncs3)c2CN1C(=O)Nc1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C17H13F3N4O2S/c1-8-2-13-10(16(26-23-13)14-5-21-7-27-14)6-24(8)17(25)22-9-3-11(18)15(20)12(19)4-9/h3-5,7-8H,2,6H2,1H3,(H,22,25) |
| InChIKey | ZUFPWVLDUIMOQM-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 71.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.38 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|