C18H22F3N3O3 — CID 155350421
tert-butyl 3-formyl-2-(6,6,6-trifluorohex-4-ynyl)-6,7-dihydro-4H-pyrazolo[4,3-c]pyridine-5-carboxylate (PubChem CID 155350421) has the molecular formula C18H22F3N3O3 and a molecular weight of 385.39 g/mol. Its IUPAC name is tert-butyl 3-formyl-2-(6,6,6-trifluorohex-4-ynyl)-6,7-dihydro-4H-pyrazolo[4,3-c]pyridine-5-carboxylate.
| Compound Name | tert-butyl 3-formyl-2-(6,6,6-trifluorohex-4-ynyl)-6,7-dihydro-4H-pyrazolo[4,3-c]pyridine-5-carboxylate |
|---|---|
| PubChem CID | 155350421 |
| Molecular Formula | C18H22F3N3O3 |
| Molecular Weight | 385.39 g/mol |
| Exact Mass | 385.16 |
| IUPAC Name | tert-butyl 3-formyl-2-(6,6,6-trifluorohex-4-ynyl)-6,7-dihydro-4H-pyrazolo[4,3-c]pyridine-5-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCc2nn(CCCC#CC(F)(F)F)c(C=O)c2C1 |
| InChI | InChI=1S/C18H22F3N3O3/c1-17(2,3)27-16(26)23-10-7-14-13(11-23)15(12-25)24(22-14)9-6-4-5-8-18(19,20)21/h12H,4,6-7,9-11H2,1-3H3 |
| InChIKey | DMMIWOYRHQHSEO-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.39 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|