C13H16N4O — CID 155350471
15-methyl-4-oxa-3,10,11,15-tetrazatetracyclo[8.7.0.02,6.012,17]heptadeca-1(17),2,5,11-tetraene (PubChem CID 155350471) has the molecular formula C13H16N4O and a molecular weight of 244.30 g/mol. Its IUPAC name is 15-methyl-4-oxa-3,10,11,15-tetrazatetracyclo[8.7.0.02,6.012,17]heptadeca-1(17),2,5,11-tetraene.
| Compound Name | 15-methyl-4-oxa-3,10,11,15-tetrazatetracyclo[8.7.0.02,6.012,17]heptadeca-1(17),2,5,11-tetraene |
|---|---|
| PubChem CID | 155350471 |
| Molecular Formula | C13H16N4O |
| Molecular Weight | 244.30 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | 15-methyl-4-oxa-3,10,11,15-tetrazatetracyclo[8.7.0.02,6.012,17]heptadeca-1(17),2,5,11-tetraene |
| SMILES | CN1CCc2nn3c(c2C1)-c1nocc1CCC3 |
| InChI | InChI=1S/C13H16N4O/c1-16-6-4-11-10(7-16)13-12-9(8-18-15-12)3-2-5-17(13)14-11/h8H,2-7H2,1H3 |
| InChIKey | YHXGLBVVIQKMPJ-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 47.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.30 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |