C16H10Br2 — CID 155350544
4,5-dibromo-1-phenylnaphthalene (PubChem CID 155350544) has the molecular formula C16H10Br2 and a molecular weight of 362.06 g/mol. Its IUPAC name is 4,5-dibromo-1-phenylnaphthalene.
| Compound Name | 4,5-dibromo-1-phenylnaphthalene |
|---|---|
| PubChem CID | 155350544 |
| Molecular Formula | C16H10Br2 |
| Molecular Weight | 362.06 g/mol |
| Exact Mass | 359.91 |
| IUPAC Name | 4,5-dibromo-1-phenylnaphthalene |
| SMILES | Brc1cccc2c(-c3ccccc3)ccc(Br)c12 |
| InChI | InChI=1S/C16H10Br2/c17-14-8-4-7-13-12(9-10-15(18)16(13)14)11-5-2-1-3-6-11/h1-10H |
| InChIKey | IRDNYORDCUFVFG-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.06 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |