C17H19ClFN3O2 — CID 155350561
N-tert-butyl-6-(3-chloro-5-fluoroanilino)-3-methoxypyridine-2-carboxamide (PubChem CID 155350561) has the molecular formula C17H19ClFN3O2 and a molecular weight of 351.81 g/mol. Its IUPAC name is N-tert-butyl-6-(3-chloro-5-fluoroanilino)-3-methoxypyridine-2-carboxamide.
| Compound Name | N-tert-butyl-6-(3-chloro-5-fluoroanilino)-3-methoxypyridine-2-carboxamide |
|---|---|
| PubChem CID | 155350561 |
| Molecular Formula | C17H19ClFN3O2 |
| Molecular Weight | 351.81 g/mol |
| Exact Mass | 351.11 |
| IUPAC Name | N-tert-butyl-6-(3-chloro-5-fluoroanilino)-3-methoxypyridine-2-carboxamide |
| SMILES | COc1ccc(Nc2cc(F)cc(Cl)c2)nc1C(=O)NC(C)(C)C |
| InChI | InChI=1S/C17H19ClFN3O2/c1-17(2,3)22-16(23)15-13(24-4)5-6-14(21-15)20-12-8-10(18)7-11(19)9-12/h5-9H,1-4H3,(H,20,21)(H,22,23) |
| InChIKey | IZNGPVYNLFZFRE-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.81 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |