C15H20FN — CID 155351116
(3S)-2,2-diethyl-3-(4-fluoro-2-methylphenyl)butanenitrile (PubChem CID 155351116) has the molecular formula C15H20FN and a molecular weight of 233.33 g/mol. Its IUPAC name is (3S)-2,2-diethyl-3-(4-fluoro-2-methylphenyl)butanenitrile.
| Compound Name | (3S)-2,2-diethyl-3-(4-fluoro-2-methylphenyl)butanenitrile |
|---|---|
| PubChem CID | 155351116 |
| Molecular Formula | C15H20FN |
| Molecular Weight | 233.33 g/mol |
| Exact Mass | 233.16 |
| IUPAC Name | (3S)-2,2-diethyl-3-(4-fluoro-2-methylphenyl)butanenitrile |
| SMILES | CCC(C#N)(CC)[C@@H](C)c1ccc(F)cc1C |
| InChI | InChI=1S/C15H20FN/c1-5-15(6-2,10-17)12(4)14-8-7-13(16)9-11(14)3/h7-9,12H,5-6H2,1-4H3/t12-/m0/s1 |
| InChIKey | KWSUYHWTJHFPLY-LBPRGKRZSA-N |
| XLogP | 4.57 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.33 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |