C27H32N8O2 — CID 155352752
2-[(3aS,6aR)-2-[2-(cyclohexylamino)-3-oxopropanoyl]-5-[4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)pyrazol-1-yl]-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrol-5-yl]acetonitrile (PubChem CID 155352752) has the molecular formula C27H32N8O2 and a molecular weight of 500.61 g/mol. Its IUPAC name is 2-[(3aS,6aR)-2-[2-(cyclohexylamino)-3-oxopropanoyl]-5-[4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)pyrazol-1-yl]-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrol-5-yl]acetonitrile.
| Compound Name | 2-[(3aS,6aR)-2-[2-(cyclohexylamino)-3-oxopropanoyl]-5-[4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)pyrazol-1-yl]-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrol-5-yl]acetonitrile |
|---|---|
| PubChem CID | 155352752 |
| Molecular Formula | C27H32N8O2 |
| Molecular Weight | 500.61 g/mol |
| Exact Mass | 500.26 |
| IUPAC Name | 2-[(3aS,6aR)-2-[2-(cyclohexylamino)-3-oxopropanoyl]-5-[4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)pyrazol-1-yl]-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrol-5-yl]acetonitrile |
| SMILES | N#CCC1(n2cc(-c3ncnc4[nH]ccc34)cn2)C[C@H]2CN(C(=O)C(C=O)NC3CCCCC3)C[C@H]2C1 |
| InChI | InChI=1S/C27H32N8O2/c28-8-7-27(35-15-20(12-32-35)24-22-6-9-29-25(22)31-17-30-24)10-18-13-34(14-19(18)11-27)26(37)23(16-36)33-21-4-2-1-3-5-21/h6,9,12,15-19,21,23,33H,1-5,7,10-11,13-14H2,(H,29,30,31)/t18-,19+,23?,27? |
| InChIKey | XXLZKOPWQNWKTP-XKXWHDDSSA-N |
| XLogP | 2.79 |
| TPSA | 132.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.61 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|