C21H24F7N5O3 — CID 155352825
(11R)-11-(2,2-difluoroethoxymethyl)-4-[[[2-(difluoromethyl)-3-fluoro-4-pyridinyl]amino]-hydroxymethyl]-14,14-difluoro-4,8,9-triazatricyclo[7.5.0.02,7]tetradeca-1,7-dien-11-ol (PubChem CID 155352825) has the molecular formula C21H24F7N5O3 and a molecular weight of 527.44 g/mol. Its IUPAC name is (11R)-11-(2,2-difluoroethoxymethyl)-4-[[[2-(difluoromethyl)-3-fluoro-4-pyridinyl]amino]-hydroxymethyl]-14,14-difluoro-4,8,9-triazatricyclo[7.5.0.02,7]tetradeca-1,7-dien-11-ol.
| Compound Name | (11R)-11-(2,2-difluoroethoxymethyl)-4-[[[2-(difluoromethyl)-3-fluoro-4-pyridinyl]amino]-hydroxymethyl]-14,14-difluoro-4,8,9-triazatricyclo[7.5.0.02,7]tetradeca-1,7-dien-11-ol |
|---|---|
| PubChem CID | 155352825 |
| Molecular Formula | C21H24F7N5O3 |
| Molecular Weight | 527.44 g/mol |
| Exact Mass | 527.18 |
| IUPAC Name | (11R)-11-(2,2-difluoroethoxymethyl)-4-[[[2-(difluoromethyl)-3-fluoro-4-pyridinyl]amino]-hydroxymethyl]-14,14-difluoro-4,8,9-triazatricyclo[7.5.0.02,7]tetradeca-1,7-dien-11-ol |
| SMILES | OC(Nc1ccnc(C(F)F)c1F)N1CCc2nn3c(c2C1)C(F)(F)CC[C@](O)(COCC(F)F)C3 |
| InChI | InChI=1S/C21H24F7N5O3/c22-14(23)8-36-10-20(35)3-4-21(27,28)17-11-7-32(6-2-12(11)31-33(17)9-20)19(34)30-13-1-5-29-16(15(13)24)18(25)26/h1,5,14,18-19,34-35H,2-4,6-10H2,(H,29,30)/t19?,20-/m1/s1 |
| InChIKey | GFGPFWJBTWNBMK-GFOWMXPYSA-N |
| XLogP | 3.00 |
| TPSA | 95.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.44 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|