C21H23F4N5O2 — CID 155353000
5-[[[(5R,12R)-14,14-difluoro-12-(fluoromethyl)-12-hydroxy-5-methyl-4,8,9-triazatricyclo[7.5.0.02,7]tetradeca-1,7-dien-4-yl]-hydroxymethyl]amino]-2-fluorobenzonitrile (PubChem CID 155353000) has the molecular formula C21H23F4N5O2 and a molecular weight of 453.44 g/mol. Its IUPAC name is 5-[[[(5R,12R)-14,14-difluoro-12-(fluoromethyl)-12-hydroxy-5-methyl-4,8,9-triazatricyclo[7.5.0.02,7]tetradeca-1,7-dien-4-yl]-hydroxymethyl]amino]-2-fluorobenzonitrile.
| Compound Name | 5-[[[(5R,12R)-14,14-difluoro-12-(fluoromethyl)-12-hydroxy-5-methyl-4,8,9-triazatricyclo[7.5.0.02,7]tetradeca-1,7-dien-4-yl]-hydroxymethyl]amino]-2-fluorobenzonitrile |
|---|---|
| PubChem CID | 155353000 |
| Molecular Formula | C21H23F4N5O2 |
| Molecular Weight | 453.44 g/mol |
| Exact Mass | 453.18 |
| IUPAC Name | 5-[[[(5R,12R)-14,14-difluoro-12-(fluoromethyl)-12-hydroxy-5-methyl-4,8,9-triazatricyclo[7.5.0.02,7]tetradeca-1,7-dien-4-yl]-hydroxymethyl]amino]-2-fluorobenzonitrile |
| SMILES | C[C@@H]1Cc2nn3c(c2CN1C(O)Nc1ccc(F)c(C#N)c1)C(F)(F)C[C@@](O)(CF)CC3 |
| InChI | InChI=1S/C21H23F4N5O2/c1-12-6-17-15(18-21(24,25)10-20(32,11-22)4-5-30(18)28-17)9-29(12)19(31)27-14-2-3-16(23)13(7-14)8-26/h2-3,7,12,19,27,31-32H,4-6,9-11H2,1H3/t12-,19?,20-/m1/s1 |
| InChIKey | BZYKXCFKCCOQCX-YVWJQDNMSA-N |
| XLogP | 2.61 |
| TPSA | 97.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.44 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|