C20H38O4Si2 — CID 15535396
methyl (1S,2E,4S,5S)-2-[tert-butyl(dimethyl)silyl]oxy-5-formyl-4-trimethylsilylcyclooct-2-ene-1-carboxylate (PubChem CID 15535396) has the molecular formula C20H38O4Si2 and a molecular weight of 398.69 g/mol. Its IUPAC name is methyl (1S,2E,4S,5S)-2-[tert-butyl(dimethyl)silyl]oxy-5-formyl-4-trimethylsilylcyclooct-2-ene-1-carboxylate.
| Compound Name | methyl (1S,2E,4S,5S)-2-[tert-butyl(dimethyl)silyl]oxy-5-formyl-4-trimethylsilylcyclooct-2-ene-1-carboxylate |
|---|---|
| PubChem CID | 15535396 |
| Molecular Formula | C20H38O4Si2 |
| Molecular Weight | 398.69 g/mol |
| Exact Mass | 398.23 |
| IUPAC Name | methyl (1S,2E,4S,5S)-2-[tert-butyl(dimethyl)silyl]oxy-5-formyl-4-trimethylsilylcyclooct-2-ene-1-carboxylate |
| SMILES | COC(=O)[C@H]1CCC[C@@H](C=O)[C@@H]([Si](C)(C)C)/C=C\1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H38O4Si2/c1-20(2,3)26(8,9)24-17-13-18(25(5,6)7)15(14-21)11-10-12-16(17)19(22)23-4/h13-16,18H,10-12H2,1-9H3/b17-13+/t15-,16-,18-/m0/s1 |
| InChIKey | LDLJOZTVBPIFIF-AXXRMEFGSA-N |
| XLogP | 5.39 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.69 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|