C9H19IN2O — CID 155354329
2-(4-ethyl-1,4-oxazepan-7-yl)-N-iodoethanamine (PubChem CID 155354329) has the molecular formula C9H19IN2O and a molecular weight of 298.17 g/mol. Its IUPAC name is 2-(4-ethyl-1,4-oxazepan-7-yl)-N-iodoethanamine.
| Compound Name | 2-(4-ethyl-1,4-oxazepan-7-yl)-N-iodoethanamine |
|---|---|
| PubChem CID | 155354329 |
| Molecular Formula | C9H19IN2O |
| Molecular Weight | 298.17 g/mol |
| Exact Mass | 298.05 |
| IUPAC Name | 2-(4-ethyl-1,4-oxazepan-7-yl)-N-iodoethanamine |
| SMILES | CCN1CCOC(CCNI)CC1 |
| InChI | InChI=1S/C9H19IN2O/c1-2-12-6-4-9(3-5-11-10)13-8-7-12/h9,11H,2-8H2,1H3 |
| InChIKey | XAVHCEATSWUNTK-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.17 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|