About 4-(2-adamantylidene)-2,6-ditert-butylcyclohexa-2,5-dien-1-one
4-(2-adamantylidene)-2,6-ditert-butylcyclohexa-2,5-dien-1-one (PubChem CID 15535454) has the molecular formula C24H34O
and a molecular weight of 338.54 g/mol. Its IUPAC name is 4-(2-adamantylidene)-2,6-ditert-butylcyclohexa-2,5-dien-1-one.
Molecular Properties
| Compound Name | 4-(2-adamantylidene)-2,6-ditert-butylcyclohexa-2,5-dien-1-one |
| PubChem CID | 15535454 |
| Molecular Formula | C24H34O |
| Molecular Weight | 338.54 g/mol |
| Exact Mass | 338.26 |
| IUPAC Name | 4-(2-adamantylidene)-2,6-ditert-butylcyclohexa-2,5-dien-1-one |
| SMILES | CC(C)(C)C1=CC(=C2C3CC4CC(C3)CC2C4)C=C(C(C)(C)C)C1=O |
| InChI | InChI=1S/C24H34O/c1-23(2,3)19-12-18(13-20(22(19)25)24(4,5)6)21-16-8-14-7-15(10-16)11-17(21)9-14/h12-17H,7-11H2,1-6H3 |
| InChIKey | JVQJHDNAHNJATL-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 338.54 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-(2-adamantylidene)-2,6-ditert-butylcyclohexa-2,5-dien-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-adamantylidene)-2,6-ditert-butylcyclohexa-2,5-dien-1-one?
The IUPAC name of 4-(2-adamantylidene)-2,6-ditert-butylcyclohexa-2,5-dien-1-one (CID 15535454) is 4-(2-adamantylidene)-2,6-ditert-butylcyclohexa-2,5-dien-1-one.
What is the SMILES notation for 4-(2-adamantylidene)-2,6-ditert-butylcyclohexa-2,5-dien-1-one?
The canonical SMILES for 4-(2-adamantylidene)-2,6-ditert-butylcyclohexa-2,5-dien-1-one is CC(C)(C)C1=CC(=C2C3CC4CC(C3)CC2C4)C=C(C(C)(C)C)C1=O.
What is the InChIKey of 4-(2-adamantylidene)-2,6-ditert-butylcyclohexa-2,5-dien-1-one?
The InChIKey is JVQJHDNAHNJATL-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H34O/c1-23(2,3)19-12-18(13-20(22(19)25)24(4,5)6)21-16-8-14-7-15(10-16)11-17(21)9-14/h12-17H,7-11H2,1-6H3.
What are the key properties of 4-(2-adamantylidene)-2,6-ditert-butylcyclohexa-2,5-dien-1-one?
4-(2-adamantylidene)-2,6-ditert-butylcyclohexa-2,5-dien-1-one has a molecular weight of 338.54 g/mol, XLogP of 6.27, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-adamantylidene)-2,6-ditert-butylcyclohexa-2,5-dien-1-one is sourced from PubChem (CID 15535454), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).