C11H5F3N6OS — CID 155354663
3-prop-2-ynyl-8-[4-(trifluoromethyl)-1,3-thiazol-2-yl]imidazo[5,1-d][1,2,3,5]tetrazin-4-one (PubChem CID 155354663) has the molecular formula C11H5F3N6OS and a molecular weight of 326.26 g/mol. Its IUPAC name is 3-prop-2-ynyl-8-[4-(trifluoromethyl)-1,3-thiazol-2-yl]imidazo[5,1-d][1,2,3,5]tetrazin-4-one.
| Compound Name | 3-prop-2-ynyl-8-[4-(trifluoromethyl)-1,3-thiazol-2-yl]imidazo[5,1-d][1,2,3,5]tetrazin-4-one |
|---|---|
| PubChem CID | 155354663 |
| Molecular Formula | C11H5F3N6OS |
| Molecular Weight | 326.26 g/mol |
| Exact Mass | 326.02 |
| IUPAC Name | 3-prop-2-ynyl-8-[4-(trifluoromethyl)-1,3-thiazol-2-yl]imidazo[5,1-d][1,2,3,5]tetrazin-4-one |
| SMILES | C#CCn1nnc2c(-c3nc(C(F)(F)F)cs3)ncn2c1=O |
| InChI | InChI=1S/C11H5F3N6OS/c1-2-3-20-10(21)19-5-15-7(8(19)17-18-20)9-16-6(4-22-9)11(12,13)14/h1,4-5H,3H2 |
| InChIKey | TULWETNCKANTME-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 77.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.26 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|