C21H15F6N5O4 — CID 155355189
[2-[3-[8-amino-6-(1,3-oxazol-5-yl)imidazo[1,2-a]pyrazin-3-yl]-4-methylphenyl]-1,1,1-trifluoro-3-hydroxypropan-2-yl] 2,2,2-trifluoroacetate (PubChem CID 155355189) has the molecular formula C21H15F6N5O4 and a molecular weight of 515.37 g/mol. Its IUPAC name is [2-[3-[8-amino-6-(1,3-oxazol-5-yl)imidazo[1,2-a]pyrazin-3-yl]-4-methylphenyl]-1,1,1-trifluoro-3-hydroxypropan-2-yl] 2,2,2-trifluoroacetate.
| Compound Name | [2-[3-[8-amino-6-(1,3-oxazol-5-yl)imidazo[1,2-a]pyrazin-3-yl]-4-methylphenyl]-1,1,1-trifluoro-3-hydroxypropan-2-yl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 155355189 |
| Molecular Formula | C21H15F6N5O4 |
| Molecular Weight | 515.37 g/mol |
| Exact Mass | 515.10 |
| IUPAC Name | [2-[3-[8-amino-6-(1,3-oxazol-5-yl)imidazo[1,2-a]pyrazin-3-yl]-4-methylphenyl]-1,1,1-trifluoro-3-hydroxypropan-2-yl] 2,2,2-trifluoroacetate |
| SMILES | Cc1ccc(C(CO)(OC(=O)C(F)(F)F)C(F)(F)F)cc1-c1cnc2c(N)nc(-c3cnco3)cn12 |
| InChI | InChI=1S/C21H15F6N5O4/c1-10-2-3-11(19(8-33,21(25,26)27)36-18(34)20(22,23)24)4-12(10)14-5-30-17-16(28)31-13(7-32(14)17)15-6-29-9-35-15/h2-7,9,33H,8H2,1H3,(H2,28,31) |
| InChIKey | OUORFGGPELLYGG-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 128.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.37 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |