C22H17F6N5O3S — CID 155355195
[2-[3-[8-amino-6-(2-methyl-1,3-thiazol-5-yl)imidazo[1,2-a]pyrazin-3-yl]-4-methylphenyl]-1,1,1-trifluoro-3-hydroxypropan-2-yl] 2,2,2-trifluoroacetate (PubChem CID 155355195) has the molecular formula C22H17F6N5O3S and a molecular weight of 545.47 g/mol. Its IUPAC name is [2-[3-[8-amino-6-(2-methyl-1,3-thiazol-5-yl)imidazo[1,2-a]pyrazin-3-yl]-4-methylphenyl]-1,1,1-trifluoro-3-hydroxypropan-2-yl] 2,2,2-trifluoroacetate.
| Compound Name | [2-[3-[8-amino-6-(2-methyl-1,3-thiazol-5-yl)imidazo[1,2-a]pyrazin-3-yl]-4-methylphenyl]-1,1,1-trifluoro-3-hydroxypropan-2-yl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 155355195 |
| Molecular Formula | C22H17F6N5O3S |
| Molecular Weight | 545.47 g/mol |
| Exact Mass | 545.10 |
| IUPAC Name | [2-[3-[8-amino-6-(2-methyl-1,3-thiazol-5-yl)imidazo[1,2-a]pyrazin-3-yl]-4-methylphenyl]-1,1,1-trifluoro-3-hydroxypropan-2-yl] 2,2,2-trifluoroacetate |
| SMILES | Cc1ncc(-c2cn3c(-c4cc(C(CO)(OC(=O)C(F)(F)F)C(F)(F)F)ccc4C)cnc3c(N)n2)s1 |
| InChI | InChI=1S/C22H17F6N5O3S/c1-10-3-4-12(20(9-34,22(26,27)28)36-19(35)21(23,24)25)5-13(10)15-6-31-18-17(29)32-14(8-33(15)18)16-7-30-11(2)37-16/h3-8,34H,9H2,1-2H3,(H2,29,32) |
| InChIKey | AIJKDTLSKZYBDX-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 115.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.47 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |