C28H31Cl2N5O4 — CID 155355426
methyl N,N-bis[2-[2-[(7-chloroquinolin-4-yl)amino]ethoxy]ethyl]carbamate (PubChem CID 155355426) has the molecular formula C28H31Cl2N5O4 and a molecular weight of 572.49 g/mol. Its IUPAC name is methyl N,N-bis[2-[2-[(7-chloroquinolin-4-yl)amino]ethoxy]ethyl]carbamate.
| Compound Name | methyl N,N-bis[2-[2-[(7-chloroquinolin-4-yl)amino]ethoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 155355426 |
| Molecular Formula | C28H31Cl2N5O4 |
| Molecular Weight | 572.49 g/mol |
| Exact Mass | 571.18 |
| IUPAC Name | methyl N,N-bis[2-[2-[(7-chloroquinolin-4-yl)amino]ethoxy]ethyl]carbamate |
| SMILES | COC(=O)N(CCOCCNc1ccnc2cc(Cl)ccc12)CCOCCNc1ccnc2cc(Cl)ccc12 |
| InChI | InChI=1S/C28H31Cl2N5O4/c1-37-28(36)35(12-16-38-14-10-33-24-6-8-31-26-18-20(29)2-4-22(24)26)13-17-39-15-11-34-25-7-9-32-27-19-21(30)3-5-23(25)27/h2-9,18-19H,10-17H2,1H3,(H,31,33)(H,32,34) |
| InChIKey | KNPVAJDLHQYNPG-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 97.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.49 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|