C21H16N2O3S — CID 155355496
1-[2-acetyl-6-(1,3-benzothiazol-2-ylmethoxy)quinolin-4-yl]ethanone (PubChem CID 155355496) has the molecular formula C21H16N2O3S and a molecular weight of 376.44 g/mol. Its IUPAC name is 1-[2-acetyl-6-(1,3-benzothiazol-2-ylmethoxy)quinolin-4-yl]ethanone.
| Compound Name | 1-[2-acetyl-6-(1,3-benzothiazol-2-ylmethoxy)quinolin-4-yl]ethanone |
|---|---|
| PubChem CID | 155355496 |
| Molecular Formula | C21H16N2O3S |
| Molecular Weight | 376.44 g/mol |
| Exact Mass | 376.09 |
| IUPAC Name | 1-[2-acetyl-6-(1,3-benzothiazol-2-ylmethoxy)quinolin-4-yl]ethanone |
| SMILES | CC(=O)c1cc(C(C)=O)c2cc(OCc3nc4ccccc4s3)ccc2n1 |
| InChI | InChI=1S/C21H16N2O3S/c1-12(24)15-10-19(13(2)25)22-17-8-7-14(9-16(15)17)26-11-21-23-18-5-3-4-6-20(18)27-21/h3-10H,11H2,1-2H3 |
| InChIKey | ZKKLIYHQBCBYSY-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 69.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.44 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |