C27H30N6O5S — CID 155356222
3-[[2,5-dimethoxy-4-[[(2-oxo-1,3,4,5-tetrahydro-1-benzazepin-7-yl)sulfanylamino]methyl]phenyl]methyl]-7-ethylpurine-2,6-dione (PubChem CID 155356222) has the molecular formula C27H30N6O5S and a molecular weight of 550.64 g/mol. Its IUPAC name is 3-[[2,5-dimethoxy-4-[[(2-oxo-1,3,4,5-tetrahydro-1-benzazepin-7-yl)sulfanylamino]methyl]phenyl]methyl]-7-ethylpurine-2,6-dione.
| Compound Name | 3-[[2,5-dimethoxy-4-[[(2-oxo-1,3,4,5-tetrahydro-1-benzazepin-7-yl)sulfanylamino]methyl]phenyl]methyl]-7-ethylpurine-2,6-dione |
|---|---|
| PubChem CID | 155356222 |
| Molecular Formula | C27H30N6O5S |
| Molecular Weight | 550.64 g/mol |
| Exact Mass | 550.20 |
| IUPAC Name | 3-[[2,5-dimethoxy-4-[[(2-oxo-1,3,4,5-tetrahydro-1-benzazepin-7-yl)sulfanylamino]methyl]phenyl]methyl]-7-ethylpurine-2,6-dione |
| SMILES | CCn1cnc2c1c(=O)[nH]c(=O)n2Cc1cc(OC)c(CNSc2ccc3c(c2)CCCC(=O)N3)cc1OC |
| InChI | InChI=1S/C27H30N6O5S/c1-4-32-15-28-25-24(32)26(35)31-27(36)33(25)14-18-12-21(37-2)17(11-22(18)38-3)13-29-39-19-8-9-20-16(10-19)6-5-7-23(34)30-20/h8-12,15,29H,4-7,13-14H2,1-3H3,(H,30,34)(H,31,35,36) |
| InChIKey | GKPDWCPWMZFIRL-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 132.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.64 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|