C17H22NOP — CID 15535631
(1R,2R,4S,7R)-N,N,5,6-tetramethyl-7-phenyl-7-phosphabicyclo[2.2.1]hept-5-ene-2-carboxamide (PubChem CID 15535631) has the molecular formula C17H22NOP and a molecular weight of 287.34 g/mol. Its IUPAC name is (1R,2R,4S,7R)-N,N,5,6-tetramethyl-7-phenyl-7-phosphabicyclo[2.2.1]hept-5-ene-2-carboxamide.
| Compound Name | (1R,2R,4S,7R)-N,N,5,6-tetramethyl-7-phenyl-7-phosphabicyclo[2.2.1]hept-5-ene-2-carboxamide |
|---|---|
| PubChem CID | 15535631 |
| Molecular Formula | C17H22NOP |
| Molecular Weight | 287.34 g/mol |
| Exact Mass | 287.14 |
| IUPAC Name | (1R,2R,4S,7R)-N,N,5,6-tetramethyl-7-phenyl-7-phosphabicyclo[2.2.1]hept-5-ene-2-carboxamide |
| SMILES | CC1=C(C)[C@H]2[C@@H](C(=O)N(C)C)C[C@@H]1[P@@]2c1ccccc1 |
| InChI | InChI=1S/C17H22NOP/c1-11-12(2)16-14(17(19)18(3)4)10-15(11)20(16)13-8-6-5-7-9-13/h5-9,14-16H,10H2,1-4H3/t14-,15-,16-,20+/m0/s1 |
| InChIKey | LLKXSLVZADDLAI-ZKNHNOBHSA-N |
| XLogP | 2.99 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.34 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|