About 2-bromo-5-(4-bromo-1,1,1-trifluorobutan-2-yl)pyridine
2-bromo-5-(4-bromo-1,1,1-trifluorobutan-2-yl)pyridine (PubChem CID 155356506) has the molecular formula C9H8Br2F3N
and a molecular weight of 346.97 g/mol. Its IUPAC name is 2-bromo-5-(4-bromo-1,1,1-trifluorobutan-2-yl)pyridine.
Molecular Properties
| Compound Name | 2-bromo-5-(4-bromo-1,1,1-trifluorobutan-2-yl)pyridine |
| PubChem CID | 155356506 |
| Molecular Formula | C9H8Br2F3N |
| Molecular Weight | 346.97 g/mol |
| Exact Mass | 344.90 |
| IUPAC Name | 2-bromo-5-(4-bromo-1,1,1-trifluorobutan-2-yl)pyridine |
| SMILES | FC(F)(F)C(CCBr)c1ccc(Br)nc1 |
| InChI | InChI=1S/C9H8Br2F3N/c10-4-3-7(9(12,13)14)6-1-2-8(11)15-5-6/h1-2,5,7H,3-4H2 |
| InChIKey | OFQHIHCDWOLJDK-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.97 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-5-(4-bromo-1,1,1-trifluorobutan-2-yl)pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-5-(4-bromo-1,1,1-trifluorobutan-2-yl)pyridine?
The IUPAC name of 2-bromo-5-(4-bromo-1,1,1-trifluorobutan-2-yl)pyridine (CID 155356506) is 2-bromo-5-(4-bromo-1,1,1-trifluorobutan-2-yl)pyridine.
What is the SMILES notation for 2-bromo-5-(4-bromo-1,1,1-trifluorobutan-2-yl)pyridine?
The canonical SMILES for 2-bromo-5-(4-bromo-1,1,1-trifluorobutan-2-yl)pyridine is FC(F)(F)C(CCBr)c1ccc(Br)nc1.
What is the InChIKey of 2-bromo-5-(4-bromo-1,1,1-trifluorobutan-2-yl)pyridine?
The InChIKey is OFQHIHCDWOLJDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8Br2F3N/c10-4-3-7(9(12,13)14)6-1-2-8(11)15-5-6/h1-2,5,7H,3-4H2.
What are the key properties of 2-bromo-5-(4-bromo-1,1,1-trifluorobutan-2-yl)pyridine?
2-bromo-5-(4-bromo-1,1,1-trifluorobutan-2-yl)pyridine has a molecular weight of 346.97 g/mol, XLogP of 4.28, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-5-(4-bromo-1,1,1-trifluorobutan-2-yl)pyridine is sourced from PubChem (CID 155356506), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).